2-Chloro-4-(2-ethylpiperidine-1-carboxamido)benzene-1-sulfonyl chloride
2-chloro-4-[(2-ethylpiperidine-1-carbonyl)amino]benzenesulfonyl chloride
Also Known As: 2-Chloro-4-(2-ethylpiperidine-1-carboxamido)benzene-1-sulfonyl chloride|2-chloro-4-[(2-ethylpiperidine-1-carbonyl)amino]benzenesulfonyl Chloride|2-Chloro-4-[(2-ethyl-piperidine-1-carbonyl)-amino]-benzenesulfonyl chloride|2-Chloro-4-(2-ethylpiperidine-1-carboxamido)benzene-1-sulfonylchloride
| Molecular Formula | C14H18Cl2N2O3S |
|---|---|
| Molecular Weight | 364.0415 g/mol |
| LogP | 4.0639 |
| Topological Polar Surface Area | 66.48 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 364.0415 |
| Monoisotopic Mass | 364.0415 |
| Heavy Atoms | 22 |
| Complexity | 664.0518 |
Chemical Identifiers
| CAS Number | 728864-74-2 |
|---|---|
| SMILES | CCC1CCCCN1C(=O)NC2=CC(=C(C=C2)S(=O)(=O)Cl)Cl |
Product Overview
2-Chloro-4-(2-ethylpiperidine-1-carboxamido)benzene-1-sulfonyl chloride (CAS 728864-74-2), with molecular formula C14H18Cl2N2O3S and molecular weight 364.0415 g/mol. IUPAC: 2-chloro-4-[(2-ethylpiperidine-1-carbonyl)amino]benzenesulfonyl chloride.
2-Chloro-4-(2-ethylpiperidine-1-carboxamido)benzene-1-sulfonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »