3-Acetylbenzenesulfonyl chloride
3-acetylbenzenesulfonyl chloride
Also Known As: 3-acetylbenzenesulfonyl Chloride|TOLAMOLOL|Benzenesulfonylchloride, 3-acetyl-|3-ACETYLBENZENE-1-SULFONYL CHLORIDE|m-chlorosulfonylacetophenone|3-Acetyl-benzenesulfonyl chloride|3-acetyl benzenesulfonyl chloride|3-acetylphenylsulfonyl chloride|AKOS BB-9466|Benzenesulfonyl chloride, 3-acetyl-|3-ACETYLBENZENESULFONYLCHLORIDE|8864AE|3-Acetylbenzenesulfonyl chloride 97%|3-ACETYLBNZENESULFONYL CLRI 1G.|3-ACETYLBNZENESULFONYL CLRI 5G.|Benzenesulfonyl chloride, 3-acetyl- (9CI)|3-Acetylbenzenesulfonyl chloride, AldrichCPR|035A162|F2169-1121|673-525-1
| Molecular Formula | C8H7ClO3S |
|---|---|
| Molecular Weight | 217.98044 g/mol |
| LogP | 1.8167 |
| Topological Polar Surface Area | 51.21 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 217.98044 |
| Monoisotopic Mass | 217.98044 |
| Heavy Atoms | 13 |
| Complexity | 436.4573 |
Chemical Identifiers
| CAS Number | 73035-16-2 |
|---|---|
| SMILES | CC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Product Overview
3-Acetylbenzenesulfonyl chloride (CAS 73035-16-2), with molecular formula C8H7ClO3S and molecular weight 217.98044 g/mol. IUPAC: 3-acetylbenzenesulfonyl chloride.