2-Pyrrolidinone, 1-((4-chlorophenyl)sulfonyl)-
1-(4-chlorophenyl)sulfonylpyrrolidin-2-one
Also Known As: 1-(4-chlorophenyl)sulfonylpyrrolidin-2-one|1- sulfonylpyrrolidin-2-one|N-(4'-Chlorobenzenesulfonyl)-2-pyrrolidone|2-Pyrrolidinone, 1-((4-chlorophenyl)sulfonyl)-|1-((4-Chlorophenyl)sulfonyl)-2-pyrrolidinone|2-Pyrrolidinone,1-[(4-chlorophenyl)sulfonyl]-|1-[(4-chlorophenyl)sulfonyl]-2-pyrrolidinone|1-[(4-chlorophenyl)sulfonyl]pyrrolidin-2-one|1-(4-Chlorobenzene-1-sulfonyl)pyrrolidin-2-one|AS-871/43478568|1-(4-CHLOROBENZENESULFONYL)PYRROLIDIN-2-ONE|SR-01000300648-1
| Molecular Formula | C10H10ClNO3S |
|---|---|
| Molecular Weight | 259.007 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 62.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 259.007 |
| Monoisotopic Mass | 259.007 |
| Heavy Atoms | 16 |
| Complexity | 368.0 |
Chemical Identifiers
| CAS Number | 73096-15-8 |
|---|---|
| SMILES | C1CC(=O)N(C1)S(=O)(=O)C2=CC=C(C=C2)Cl |
| InChIKey | MNKFPWSNHAGXGA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Pyrrolidinone, 1-((4-chlorophenyl)sulfonyl)- (CAS 73096-15-8), with molecular formula C10H10ClNO3S and molecular weight 259.007 g/mol. IUPAC: 1-(4-chlorophenyl)sulfonylpyrrolidin-2-one.