3,4-Dibromothiophene-2-carboxylic acid
3,4-dibromothiophene-2-carboxylic acid
Also Known As: 3,4-Dibromothiophene-2-carboxylic acid|KM1536|BAS 00744769|3,4-Dibromothiophene-2-carboxylicacid|3,4-Dibromo-2-thiophenecarboxylic acid|3,4-dibromo-2-thiophene carboxylic acid|3,4-Dibromo-thiophene-2-carboxylic acid|3,4-bis(bromanyl)thiophene-2-carboxylic acid|3,4-Dibromo-2-thiophenecarboxylic acid #|842-155-4|8N8
| Molecular Formula | C5H2Br2O2S |
|---|---|
| Molecular Weight | 283.81424 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 65.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 283.81424 |
| Monoisotopic Mass | 283.81424 |
| Heavy Atoms | 10 |
| Complexity | 153.0 |
Chemical Identifiers
| CAS Number | 7311-66-2 |
|---|---|
| SMILES | C1=C(C(=C(S1)C(=O)O)Br)Br |
| InChIKey | VMFBMYZXQCTXAV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,4-Dibromothiophene-2-carboxylic acid (CAS 7311-66-2), with molecular formula C5H2Br2O2S and molecular weight 283.81424 g/mol. IUPAC: 3,4-dibromothiophene-2-carboxylic acid.
3,4-Dibromothiophene-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »