Cyclohexanecarboxylic acid, 4-pentyl-, 4-propylcyclohexyl ester
(4-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate
Also Known As: 5cHCaA3cH|4-Propylcyclohexyl 4-pentylcyclohexanecarboxylate|J2.118.687B|4-propylcyclohexyl 4-pentylcyclohexane-1-carboxylate|4-Propylcyclohexyl 4-pentylcyclohexanecarboxylate #|(4-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate|Cyclohexanecarboxylic acid, 4-pentyl-, 4-propylcyclohexyl ester|4-Pentylcyclohexanecarboxylic acid 4-propylcyclohexyl ester|4-Pentylcyclohexane-1-carboxylic acid 4-propylcyclohexyl ester|trans-4-Propylcyclohexyl trans-4-pentylcyclohexanecarboxylate|(1s,4r)-4-Propylcyclohexyl (1s,4r)-4-pentylcyclohexane-1-carboxylate
| Molecular Formula | C21H38O2 |
|---|---|
| Molecular Weight | 322.28717 g/mol |
| LogP | 7.8 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Exact Mass | 322.28717 |
| Monoisotopic Mass | 322.28717 |
| Heavy Atoms | 23 |
| Complexity | 323.0 |
Chemical Identifiers
| CAS Number | 73255-65-9 |
|---|---|
| SMILES | CCCCCC1CCC(CC1)C(=O)OC2CCC(CC2)CCC |
| InChIKey | SQVAZYCIRMBSMF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Cyclohexanecarboxylic acid, 4-pentyl-, 4-propylcyclohexyl ester (CAS 73255-65-9), with molecular formula C21H38O2 and molecular weight 322.28717 g/mol. IUPAC: (4-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate.