AC1MHQW9
4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride
Also Known As: C15H19N3S.2ClH.1/2H2O|C15-H19-N3-S.2Cl-H.1/2H2-O|Piperazine, 1-(4-((4-methylphenyl)methyl)-2-thiazolyl)-, hydrochloride, hydrate (2:4:1)|((Methyl-4 benzyl)-4 thiazolyl-2)-1 piperazine dichlorhydrate hemihydrate [French]|1-(4-((4-Methylphenyl)methyl)-2-thiazolyl)piperazine hydrochloride hydrate (2:4:1)|((Methyl-4 benzyl)-4 thiazolyl-2)-1 piperazine dichlorhydrate hemihydrate|4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole dihydrochloride|1-{4-[(4-Methylphenyl)methyl]-1,3-thiazol-2-yl}piperazine--hydrogen chloride (1/2)
| Molecular Formula | C15H21Cl2N3S |
|---|---|
| Molecular Weight | 345.0833 g/mol |
| LogP | 3.29552 |
| Topological Polar Surface Area | 28.16 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 345.0833 |
| Monoisotopic Mass | 345.0833 |
| Heavy Atoms | 21 |
| Complexity | 536.1067 |
Chemical Identifiers
| CAS Number | 73553-69-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)CC2=CSC(=N2)N3CCNCC3.Cl.Cl |
Product Overview
AC1MHQW9 (CAS 73553-69-2), with molecular formula C15H21Cl2N3S and molecular weight 345.0833 g/mol. IUPAC: 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride.