Rmi 11567DA
2-(dimethylamino)-1-[8-[2-(dimethylamino)acetyl]dibenzofuran-2-yl]ethanone
Also Known As: Tilorone analog 11,567|Rmi 11567DA|RMI 11567 DA|KST-1B8185|KST-1B8186|RMI 11567|2,8-Bis(2-(dimethylamino)acetyl)dibenzofuran dihydrochloride|1,1'-dibenzo[b,d]furan-2,8-diylbis[2-(dimethylamino)ethanone]|Ethanone, 1,1'-(2,8-dibenzofurandiyl)bis(2-(dimethylamino)-|2-(dimethylamino)-1-[8-[2-(dimethylamino)acetyl]dibenzofuran-2-yl]ethanone|1,1 -(2,8-Dibenzofurandiyl)bis[2-(dimethylamino)ethanone]|1,1'-(Dibenzo[b,d]furan-2,8-diyl)bis[2-(dimethylamino)ethan-1-one]|2-(dimethylamino)-1-{12-[2-(dimethylamino)acetyl]-8-oxatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl}ethan-1-one
| Molecular Formula | C20H22N2O3 |
|---|---|
| Molecular Weight | 338.16306 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 53.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 338.16306 |
| Monoisotopic Mass | 338.16306 |
| Heavy Atoms | 25 |
| Complexity | 461.0 |
Chemical Identifiers
| CAS Number | 73554-90-2 |
|---|---|
| SMILES | CN(C)CC(=O)C1=CC2=C(C=C1)OC3=C2C=C(C=C3)C(=O)CN(C)C |
| InChIKey | BOVBIKZEYCNNDU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Rmi 11567DA (CAS 73554-90-2), with molecular formula C20H22N2O3 and molecular weight 338.16306 g/mol. IUPAC: 2-(dimethylamino)-1-[8-[2-(dimethylamino)acetyl]dibenzofuran-2-yl]ethanone.