1-(1,1-Dimethylethyl) 2-methyl 1,2-piperazinedicarboxylate
1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate
Also Known As: 1-tert-butyl 2-methyl piperazine-1,2-dicarboxylate|Methyl 1-Boc-piperazine-2-carboxylate|1-n-boc-piperazine-2-carboxylic acid methyl ester|1-N-Boc-2-piperazinecarboxylic acid methyl ester|n-boc-piperazine-2-carboxylic acid methyl ester|ACMC-20dm6n|N-1-Boc-2-piperazinecarboxylic acid methyl ester|(S)-1-N-Boc-piperazine-2-carboxylic acid methyl ester|METHYL 1-BOC-2-PIPERAZINECARBOXYLATE|Methyl (R)-1-Boc-piperazine-2-carboxylate|KS-00000AJV|AMY4387|(R)-1-N-Boc-piperazine-2-carboxylic acid methyl ester|CS-B0413|Methyl1-Boc-2-piperazinecarboxylate|1,2-PIPERAZINEDICARBOXYLIC ACID, 1-(1,1-DIMETHYLETHYL) 2-METHYL ESTER|CB-297|1-(tert-butyl) 2-methyl piperazine-1,2-dicarboxylate|AC-2376|N,N-Bis(2-chloroethyl)phosphorodiamidate
| Molecular Formula | C11H20N2O4 |
|---|---|
| Molecular Weight | 244.1423 g/mol |
| LogP | 0.3683 |
| Topological Polar Surface Area | 67.87 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 244.1423 |
| Monoisotopic Mass | 244.1423 |
| Heavy Atoms | 17 |
| Complexity | 298.3368 |
Chemical Identifiers
| CAS Number | 736136-04-2 |
|---|---|
| SMILES | CC(C)(C)OC(=O)N1CCNCC1C(=O)OC |
Product Overview
1-(1,1-Dimethylethyl) 2-methyl 1,2-piperazinedicarboxylate (CAS 736136-04-2), with molecular formula C11H20N2O4 and molecular weight 244.1423 g/mol. IUPAC: 1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate.