![2-{[(4-Chlorophenyl)carbonyl]amino}-4-phenylthiophene-3-carboxylic acid structure](/static/products/736/73696-32-9.png)
2-{[(4-Chlorophenyl)carbonyl]amino}-4-phenylthiophene-3-carboxylic acid
2-[(4-chlorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid
Also Known As: AE-848/14138270|2-[(4-chlorobenzoyl)amino]-4-phenyl-3-thiophenecarboxylic acid|2-[(4-chlorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid|2-(4-CHLOROBENZAMIDO)-4-PHENYLTHIOPHENE-3-CARBOXYLIC ACID|2-[(4-chlorobenzoyl)amino]-4-phenyl-thiophene-3-carboxylic Acid|2-{[(4-chlorophenyl)carbonyl]amino}-4-phenylthiophene-3-carboxylic acid
| Molecular Formula | C18H12ClNO3S |
|---|---|
| Molecular Weight | 357.02264 g/mol |
| LogP | 5.019 |
| Topological Polar Surface Area | 66.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 357.02264 |
| Monoisotopic Mass | 357.02264 |
| Heavy Atoms | 24 |
| Complexity | 888.38715 |
Chemical Identifiers
| CAS Number | 73696-32-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=CSC(=C2C(=O)O)NC(=O)C3=CC=C(C=C3)Cl |
Product Overview
2-{[(4-Chlorophenyl)carbonyl]amino}-4-phenylthiophene-3-carboxylic acid (CAS 73696-32-9), with molecular formula C18H12ClNO3S and molecular weight 357.02264 g/mol. IUPAC: 2-[(4-chlorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid.
2-{[(4-Chlorophenyl)carbonyl]amino}-4-phenylthiophene-3-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »