N2-(4-Fluorobenzyl)pyridine-2,3-diamine
2-N-[(4-fluorophenyl)methyl]pyridine-2,3-diamine
Also Known As: KS-00003O9B|N2-(4-Fluorobenzyl)pyridine-2,3-diamine|MS-1535|N2-(4-Fluorobenzyl)-2,3-pyridinediamine|(3-amino-2-pyridyl)-(4-fluorobenzyl)amine|N~2~-(4-fluorobenzyl)-2,3-pyridinediamine|2-N-[(4-fluorophenyl)methyl]pyridine-2,3-diamine|2,3-Pyridinediamine, N2-[(4-fluorophenyl)methyl]-|N-[(4-fluorophenyl)methyl]pyridine-2,3-diamine|N2-[(4-fluorophenyl)methyl]pyridine-2,3-diamine|(3-amino(2-pyridyl))[(4-fluorophenyl)methyl]amine|SR-01000308379-1|(3-amino-pyridin-2-yl)-[(4-fluorophenyl)-methyl]-amine
| Molecular Formula | C12H12FN3 |
|---|---|
| Molecular Weight | 217.10153 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 50.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 217.10153 |
| Monoisotopic Mass | 217.10153 |
| Heavy Atoms | 16 |
| Complexity | 204.0 |
Chemical Identifiers
| CAS Number | 73733-75-2 |
|---|---|
| SMILES | C1=CC(=C(N=C1)NCC2=CC=C(C=C2)F)N |
| InChIKey | SMVKMUNFPNCOAV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N2-(4-Fluorobenzyl)pyridine-2,3-diamine (CAS 73733-75-2), with molecular formula C12H12FN3 and molecular weight 217.10153 g/mol. IUPAC: 2-N-[(4-fluorophenyl)methyl]pyridine-2,3-diamine.