1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene
1-chloro-4-ethylsulfonyl-2-nitrobenzene
Also Known As: 1-chloro-4-(ethylsulfonyl)-2-nitrobenzene|1-chloro-4-ethylsulfonyl-2-nitrobenzene|EINECS 277-737-1|2-Nitro-4-ethylsulfonylchlorobenzene|ethyl 4-chloro-3-nitrophenyl sulphone|1-Chloro-4-(ethylsulphonyl)-2-nitrobenzene|1511AC|2-NITRO-4-ETHYLSULFONYL CHLOROBENZENE|1-chloro-4-ethylsulfonyl-2-nitro-benzene|1-chloro4-ethylsulfonyl-2-nitrobenzene|1-CHLORO-4-(ETHANESULFONYL)-2-NITROBENZENE|Benzene,1-chloro-4-(ethylsulfonyl)-2-nitro-|Benzene, 1-chloro-4-(ethylsulfonyl)-2-nitro-|DI[TRIS(HYDROXYMETHYL)AMINOMETHANE]OXALATE|159N801|A2962/0124751
| Molecular Formula | C8H8ClNO4S |
|---|---|
| Molecular Weight | 248.98625 g/mol |
| LogP | 2.0418 |
| Topological Polar Surface Area | 77.28 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 248.98625 |
| Monoisotopic Mass | 248.98625 |
| Heavy Atoms | 15 |
| Complexity | 497.3632 |
Chemical Identifiers
| CAS Number | 74159-80-1 |
|---|---|
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Product Overview
1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene (CAS 74159-80-1), with molecular formula C8H8ClNO4S and molecular weight 248.98625 g/mol. IUPAC: 1-chloro-4-ethylsulfonyl-2-nitrobenzene.