Ethyl 3-methyl-3-(p-tolyl)glycidate
ethyl 3-methyl-3-(4-methylphenyl)oxirane-2-carboxylate
Also Known As: Ethyl methyl-p-tolylglycidate|FEMA No. 3757|Ethyl methyl-p-methylphenylglycidate|Ethyl 2,3-epoxy-3-p-tolylbutyrate|ethyl 3-methyl-3-(4-methylphenyl)oxirane-2-carboxylate|Ethyl 3-methyl-3-(p-tolyl)glycidate|EINECS 277-844-3|Ethyl methyl-p-tolyl glycidate|ethyl2,3-epoxy-3-p-tolylbutyrate|ethyl methyl-para-tolyl glycidate|FEMA 3757|AI3-07122|Ethyl 3-methyl-3-(4-methylphenyl)oxiranecarboxylate|ETHYL METHYL-P-TOLYLGLYCIDATE [FHFI]|Ethyl 3-methyl-3-(p-tolyl)oxirane-2-carboxylate|Oxiranecarboxylic acid, 3-methyl-3-(4-methylphenyl)-, ethyl ester|3-Methyl-3-(4-methylphenyl)oxirane-2-carboxylic acid ethyl ester|Oxiranecarboxylic acid, 3-methyl-3-(4-methylphenyl)-, ethylester|2-OXIRANECARBOXYLIC ACID, 3-METHYL-3-(4-METHYLPHENYL)-, ETHYL ESTER|277-844-3
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.10994 g/mol |
| LogP | 2.17212 |
| Topological Polar Surface Area | 38.83 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 220.10994 |
| Monoisotopic Mass | 220.10994 |
| Heavy Atoms | 16 |
| Complexity | 396.14368 |
Chemical Identifiers
| CAS Number | 74367-97-8 |
|---|---|
| SMILES | CCOC(=O)C1C(O1)(C)C2=CC=C(C=C2)C |
Product Overview
Ethyl 3-methyl-3-(p-tolyl)glycidate (CAS 74367-97-8), with molecular formula C13H16O3 and molecular weight 220.10994 g/mol. IUPAC: ethyl 3-methyl-3-(4-methylphenyl)oxirane-2-carboxylate.