4-(4-Bromobenzene-1-sulfonyl)aniline
4-(4-bromophenyl)sulfonylaniline
Also Known As: 4-[(4-bromobenzene)sulfonyl]aniline|Sulfone Analogs|4-(4-bromophenyl)sulfonylaniline|4-AMINO-4'-BROMODIPHENYLSULFONE|4-(4-bromobenzenesulfonyl)aniline|4-((4-Bromophenyl)sulfonyl)aniline|4-[(4-bromophenyl)sulfonyl]aniline|4-(4-bromophenylsulfonyl)aniline|4-(4-Bromobenzene-1-sulfonyl)aniline|4-(4-bromophenylsulphonyl)-aniline|4-[(4-bromophenyl)sulfonyl]Benzenamine|4-[(4-bromophenyl)sulfonyl]phenylamine|Benzenamine, 4-[(4-bromophenyl)sulfonyl]-|4-(4-BROMOPHENYLSULFONYL)-ANILINE|Benzenamine,4-[(4-bromophenyl)sulfonyl]-|4-AMINO-4'-BROMODIPHENYLSULFONE|AB00999640-01
| Molecular Formula | C12H10BrNO2S |
|---|---|
| Molecular Weight | 310.96155 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 68.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 310.96155 |
| Monoisotopic Mass | 310.96155 |
| Heavy Atoms | 17 |
| Complexity | 336.0 |
Chemical Identifiers
| CAS Number | 745-35-7 |
|---|---|
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)Br |
| InChIKey | NQFSNUDQTQPXEH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(4-Bromobenzene-1-sulfonyl)aniline (CAS 745-35-7), with molecular formula C12H10BrNO2S and molecular weight 310.96155 g/mol. IUPAC: 4-(4-bromophenyl)sulfonylaniline.
4-(4-Bromobenzene-1-sulfonyl)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »