Amethobenzepine fumarate
(E)-but-2-enedioic acid;2-(6,11-dihydrobenzo[c][1]benzothiepin-11-yloxy)-N,N-dimethylethanamine
Also Known As: Amethobenzepine fumarate|2-((6,11-Dihydrodibenzo(b,e)thiepin-11-yl)oxy)-N,N-dimethylethylamine fumarate|Ethylamine, 2-((6,11-dihydrodibenzo(b,e)thiepin-11-yl)oxy)-N,N-dimethyl-, fumarate (1:1)|Ethylamine, 2-[(6,11-dihydrodibenzo[b,e]thiepin-11-yl)oxy]-N,N-dimethyl-, fumarate (1:1)|(E)-but-2-enedioic acid; 2-(6,11-dihydrobenzo[c][1]benzothiepin-11-yloxy)-N,N-dimethylethanamine|Ethanamine, 2-[(6,11-dihydrodibenzo[b,e]thiepin-11-yl)oxy]-N,N-dimethyl-, (E)-2-butenedioate (1:1)
| Molecular Formula | C22H25NO5S |
|---|---|
| Molecular Weight | 415.14536 g/mol |
| LogP | 3.6717 |
| Topological Polar Surface Area | 87.07 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 415.14536 |
| Monoisotopic Mass | 415.14536 |
| Heavy Atoms | 29 |
| Complexity | 802.2861 |
Chemical Identifiers
| CAS Number | 747-44-4 |
|---|---|
| SMILES | CN(C)CCOC1C2=CC=CC=C2CSC3=CC=CC=C13.C(=C/C(=O)O)\C(=O)O |
Product Overview
Amethobenzepine fumarate (CAS 747-44-4), with molecular formula C22H25NO5S and molecular weight 415.14536 g/mol. IUPAC: (E)-but-2-enedioic acid;2-(6,11-dihydrobenzo[c][1]benzothiepin-11-yloxy)-N,N-dimethylethanamine.