![Borane, [1,2-bis(1-methylethyl)butyl]bis(1-methylethyl)- structure](/static/products/7479/74792-79-3.webp)
Borane, [1,2-bis(1-methylethyl)butyl]bis(1-methylethyl)-
(4-ethyl-2,5-dimethylhexan-3-yl)-di(propan-2-yl)borane
Also Known As: [1,2-Bis butyl]bis borane|Borane, [1,2-bis(1-methylethyl)butyl]bis(1-methylethyl)-|(2-Ethyl-1-isopropyl-3-methylbutyl)(diisopropyl)borane|(4-Ethyl-2,5-dimethylhexan-3-yl)di(propan-2-yl)borane|[1,2-Bis(1-methylethyl)butyl]bis(1-methylethyl)borane|(2-Ethyl-1-isopropyl-3-methylbutyl)(diisopropyl)borane #|(4-ethyl-2,5-dimethylhexan-3-yl)-di(propan-2-yl)borane|(4-ethyl-2,5-dimethylhexan-3-yl)bis(propan-2-yl)borane
| Molecular Formula | C16H35B |
|---|---|
| Molecular Weight | 238.28319 g/mol |
| LogP | 6.0096 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 7 |
| Exact Mass | 238.28319 |
| Monoisotopic Mass | 238.28319 |
| Heavy Atoms | 17 |
| Complexity | 186.0 |
Chemical Identifiers
| CAS Number | 74792-79-3 |
|---|---|
| SMILES | B(C(C)C)(C(C)C)C(C(C)C)C(CC)C(C)C |
| InChIKey | ADTFWMSGAIHAFN-UHFFFAOYSA-N |
Product Overview
Borane, [1,2-bis(1-methylethyl)butyl]bis(1-methylethyl)- (CAS 74792-79-3), with molecular formula C16H35B and molecular weight 238.28319 g/mol. IUPAC: (4-ethyl-2,5-dimethylhexan-3-yl)-di(propan-2-yl)borane.
Borane, [1,2-bis(1-methylethyl)butyl]bis(1-methylethyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »