2,5-Dimethyl-1-m-tolyl-1H-pyrrole-3-carboxylic acid
2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid
Also Known As: 2,5-Dimethyl-1-m-tolyl-1H-pyrrole-3-carboxylic acid|2,5-dimethyl-1-(3-methylphenyl)-1H-pyrrole-3-carboxylic acid|2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic Acid|2,5-Dimethyl-1-(m-tolyl)-1H-pyrrole-3-carboxylic acid|2,5-dimethyl-1-(m-tolyl)pyrrole-3-carboxylic acid|2,5-Dimethyl-1-(m-tolyl)-1H-pyrrole-3-carboxylicacid
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.11028 g/mol |
| LogP | 3.10076 |
| Topological Polar Surface Area | 42.23 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 229.11028 |
| Monoisotopic Mass | 229.11028 |
| Heavy Atoms | 17 |
| Complexity | 581.9033 |
Chemical Identifiers
| CAS Number | 749219-01-0 |
|---|---|
| SMILES | CC1=CC(=CC=C1)N2C(=CC(=C2C)C(=O)O)C |
Product Overview
2,5-Dimethyl-1-m-tolyl-1H-pyrrole-3-carboxylic acid (CAS 749219-01-0), with molecular formula C14H15NO2 and molecular weight 229.11028 g/mol. IUPAC: 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid.
2,5-Dimethyl-1-m-tolyl-1H-pyrrole-3-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »