1,2-Dichloro-4-methyl-5-nitrobenzene
1,2-dichloro-4-methyl-5-nitrobenzene
Also Known As: 1,2-dichloro-4-methyl-5-nitrobenzene|4,5-Dichloro-2-nitrotoluene|3,4-DICHLORO-6-NITROTOLUENE|ACMC-209owl|2-nitro-4,5-dichlorotoluene|4.5-dichloro-2-nitrotoluene|4,5-Dichloro-2-Methylnitrobenzene|Ethyl 3,4-difluorobenzoylformate|KS-000012YX|4,5-Dichloro-2-methyl-nitrobenzene|1-Nitro-2-methyl-4,5-dichlorobenzene|Benzene, 1,2-dichloro-4-methyl-5-nitro-|1,2-Dichloro-4-methyl-5-nitro-benzene|Benzene,1,2-dichloro-4-methyl-5-nitro-
| Molecular Formula | C7H5Cl2NO2 |
|---|---|
| Molecular Weight | 204.96973 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 45.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 204.96973 |
| Monoisotopic Mass | 204.96973 |
| Heavy Atoms | 12 |
| Complexity | 183.0 |
Chemical Identifiers
| CAS Number | 7494-45-3 |
|---|---|
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)Cl |
| InChIKey | AOTWCYSQDSKAQT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2-Dichloro-4-methyl-5-nitrobenzene (CAS 7494-45-3), with molecular formula C7H5Cl2NO2 and molecular weight 204.96973 g/mol. IUPAC: 1,2-dichloro-4-methyl-5-nitrobenzene.
1,2-Dichloro-4-methyl-5-nitrobenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »