Butanoic acid, 2-(aminocarbonyl)-3-methyl-2-(1-methylethyl)-
2-carbamoyl-3-methyl-2-propan-2-ylbutanoic acid
Also Known As: Malonamic acid, 2,2-diisopropyl-|2,2-Diisopropylmalonoic acid monoamide|2-carbamoyl-3-methyl-2-propan-2-ylbutanoic acid|2-carbamoyl-3-methyl-2-(propan-2-yl)butanoic acid|2-Carbamoyl-2-isopropyl-3-methylbutanoicacid|2-Carbamoyl-2-isopropyl-3-methylbutanoic acid|Butanoic acid, 2-(aminocarbonyl)-3-methyl-2-(1-methylethyl)-|2-(Aminocarbonyl)-2-isopropyl-3-methylbutanoic acid #|2-(Aminocarbonyl)-3-methyl-2-(1-methylethyl)butyric acid
| Molecular Formula | C9H17NO3 |
|---|---|
| Molecular Weight | 187.12085 g/mol |
| LogP | 1.4 |
| Topological Polar Surface Area | 80.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 187.12085 |
| Monoisotopic Mass | 187.12085 |
| Heavy Atoms | 13 |
| Complexity | 213.0 |
Chemical Identifiers
| CAS Number | 7499-15-2 |
|---|---|
| SMILES | CC(C)C(C(C)C)(C(=O)N)C(=O)O |
| InChIKey | BQOUKOFSUDJODA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Butanoic acid, 2-(aminocarbonyl)-3-methyl-2-(1-methylethyl)- (CAS 7499-15-2), with molecular formula C9H17NO3 and molecular weight 187.12085 g/mol. IUPAC: 2-carbamoyl-3-methyl-2-propan-2-ylbutanoic acid.