(2-Phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid
2-(2-phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid
Also Known As: 2-(2-phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid|1-Phenanthreneaceticacid, 1,2,3,4-tetrahydro-2-phenyl-|(2-phenyl-1,2,3,4-tetrahydro-[1]phenanthryl)-acetic acid|(2-Phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid|2-[(1R,2R)-2-phenyl-1,2,3,4-tetrahydrophenanthren-1-yl]acetic acid|2-[(1R,2S)-2-phenyl-1,2,3,4-tetrahydrophenanthren-1-yl]acetic acid
| Molecular Formula | C22H20O2 |
|---|---|
| Molecular Weight | 316.14633 g/mol |
| LogP | 5.0 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 316.14633 |
| Monoisotopic Mass | 316.14633 |
| Heavy Atoms | 24 |
| Complexity | 439.0 |
Chemical Identifiers
| CAS Number | 7499-36-7 |
|---|---|
| SMILES | C1CC2=C(C=CC3=CC=CC=C23)C(C1C4=CC=CC=C4)CC(=O)O |
| InChIKey | MDNNIXBDLRFUEB-UHFFFAOYSA-N |
Product Overview
(2-Phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid (CAS 7499-36-7), with molecular formula C22H20O2 and molecular weight 316.14633 g/mol. IUPAC: 2-(2-phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid.
(2-Phenyl-1,2,3,4-tetrahydrophenanthren-1-yl)acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »