![6-(1-Hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane-7-carboxylic acid structure](/static/products/7507/7507-46-2.webp)
6-(1-Hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane-7-carboxylic acid
7-(1-hydroxyethyl)-4-methyl-2-oxo-3-oxabicyclo[3.2.0]heptane-6-carboxylic acid
Also Known As: 6-(1-hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane-7-carboxylic acid|6-(1-hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane|7-(1-Hydroxyethyl)-4-methyl-2-oxo-3-oxabicyclo[3.2.0]heptane-6-carboxylic acid
| Molecular Formula | C10H14O5 |
|---|---|
| Molecular Weight | 214.08412 g/mol |
| LogP | -0.1 |
| Topological Polar Surface Area | 83.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 214.08412 |
| Monoisotopic Mass | 214.08412 |
| Heavy Atoms | 15 |
| Complexity | 313.0 |
Chemical Identifiers
| CAS Number | 7507-46-2 |
|---|---|
| SMILES | CC1C2C(C(C2C(=O)O)C(C)O)C(=O)O1 |
| InChIKey | RQKBYROWXSBHDO-UHFFFAOYSA-N |
Product Overview
6-(1-Hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane-7-carboxylic acid (CAS 7507-46-2), with molecular formula C10H14O5 and molecular weight 214.08412 g/mol. IUPAC: 7-(1-hydroxyethyl)-4-methyl-2-oxo-3-oxabicyclo[3.2.0]heptane-6-carboxylic acid.
6-(1-Hydroxyethyl)-2-methyl-4-oxo-3-oxabicyclo[3.2.0]heptane-7-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »