Butylphenyl methylpropional, (+)-
(2S)-3-(4-tert-butylphenyl)-2-methylpropanal
Also Known As: (S)-Silvial|Butylphenyl methylpropional, (+)-|(S)-butylphenyl methylpropional|BUTYLPHENYL METHYLPROPIONAL, (S)-|(2S)-3-(4-tert-butylphenyl)-2-methylpropanal|NCGC00091024-01|(S)-4-tert-Butyl-alpha-methylbenzenepropanal|(S)-alpha-Methyl-4-tert-butylbenzenepropanal|J3.054.748I|(+)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL|(S)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL|BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (S)-|BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (.ALPHA.S)-|BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-ALPHA-METHYL-, (S)-|BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-ALPHA-METHYL-, (ALPHAS)-
| Molecular Formula | C14H20O |
|---|---|
| Molecular Weight | 204.15141 g/mol |
| LogP | 3.3616 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 204.15141 |
| Monoisotopic Mass | 204.15141 |
| Heavy Atoms | 15 |
| Complexity | 316.1871 |
Chemical Identifiers
| CAS Number | 75166-30-2 |
|---|---|
| SMILES | C[C@@H](CC1=CC=C(C=C1)C(C)(C)C)C=O |
Product Overview
Butylphenyl methylpropional, (+)- (CAS 75166-30-2), with molecular formula C14H20O and molecular weight 204.15141 g/mol. IUPAC: (2S)-3-(4-tert-butylphenyl)-2-methylpropanal.