AC1MHVX8
2-(diethylamino)ethyl 2-(N-ethylanilino)pyridine-3-carboxylate;hydrochloride
Also Known As: 3-Pyridinecarboxylic acid, 2-(ethylphenylamino)-, 2-(diethylamino)ethyl ester, monohydrochloride|2-(Ethylphenylamino)-3-pyridinecarboxylic acid 2-(diethylamino)ethyl ester hydrochloride|2-3-pyridinecarboxylicacid2- ethylesterhydrochloride|2- -3-pyridinecarboxylicacid2- ethylesterhydrochloride|2-diethylaminoethyl 2-(N-ethylanilino)pyridine-3-carboxylate hydrochloride|2-(diethylamino)ethyl 2-(N-ethylanilino)pyridine-3-carboxylate,hydrochloride|2-(Diethylamino)ethyl 2-[ethyl(phenyl)amino]pyridine-3-carboxylate--hydrogen chloride (1/1)
| Molecular Formula | C20H28ClN3O2 |
|---|---|
| Molecular Weight | 377.187 g/mol |
| LogP | 4.16 |
| Topological Polar Surface Area | 45.67 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 377.187 |
| Monoisotopic Mass | 377.187 |
| Heavy Atoms | 26 |
| Complexity | 663.11566 |
Chemical Identifiers
| CAS Number | 75449-68-2 |
|---|---|
| SMILES | CCN(CC)CCOC(=O)C1=C(N=CC=C1)N(CC)C2=CC=CC=C2.Cl |
Product Overview
AC1MHVX8 (CAS 75449-68-2), with molecular formula C20H28ClN3O2 and molecular weight 377.187 g/mol. IUPAC: 2-(diethylamino)ethyl 2-(N-ethylanilino)pyridine-3-carboxylate;hydrochloride.