N-benzyl-4-phenylbutan-2-amine
N-benzyl-4-phenylbutan-2-amine
Also Known As: N-benzyl-4-phenylbutan-2-amine|2-BENZYLAMINO-4-PHENYLBUTANE|benzyl(4-phenylbutan-2-yl)amine|3-BENZYLAMINO-1-PHENYLBUTANE|N-Benzyl-4-phenyl-2-butaneamine|N-Benzyl-4-phenylbutane-2-amine|N-benzyl-4-phenyl-butan-2-amine|N-Benzyl-1-methyl-3-phenyl-1-propanamine|N-benzyl-N-(1-methyl-3-phenylpropyl)amine|J1.296.728D|N-(1-Methyl-3-phenylpropyl)benzenemethaneamine|(alphaR)-alpha-Methyl-N-(phenylmethyl)benzenepropanamine|AN-465/43430239|N-(1-methyl-3-phenylpropyl)-N-(phenylmethyl) amine|N-(1-methyl-3-phenylpropyl)-N-(phenylmethyl)amine
| Molecular Formula | C17H21N |
|---|---|
| Molecular Weight | 239.1674 g/mol |
| LogP | 3.7975 |
| Topological Polar Surface Area | 12.03 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Exact Mass | 239.1674 |
| Monoisotopic Mass | 239.1674 |
| Heavy Atoms | 18 |
| Complexity | 392.18198 |
Chemical Identifiers
| CAS Number | 75659-06-2 |
|---|---|
| SMILES | CC(CCC1=CC=CC=C1)NCC2=CC=CC=C2 |
Product Overview
N-benzyl-4-phenylbutan-2-amine (CAS 75659-06-2), with molecular formula C17H21N and molecular weight 239.1674 g/mol. IUPAC: N-benzyl-4-phenylbutan-2-amine.
N-benzyl-4-phenylbutan-2-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »