(1,1'-Biphenyl)-3-acetic acid, 4'-methoxy-
2-[3-(4-methoxyphenyl)phenyl]acetic acid
Also Known As: (4'-Methoxy-biphenyl-3-yl)-acetic acid|3-biphenyl-(4'-methoxy)acetic acid|(1,1'-Biphenyl)-3-acetic acid, 4'-methoxy-|4'-methoxy-biphenyl-3-acetic acid|2-[3-(4-methoxyphenyl)phenyl]acetic acid|3-Biphenyl-(4'-methoxy)aceticacid|[3-(4-METHOXYPHENYL)PHENYL]ACETIC ACID|(4'-methoxybiphenyl-3-yl)acetic acid|4'-Methoxy-(1,1'-biphenyl)-3-acetic acid|3-Biphenyl-(4-methoxy)acetic acid|2-(4'-Methoxy-[1,1'-biphenyl]-3-yl)acetic acid|2-(4'-Methoxy-[1,1'-biphenyl]-3-yl)aceticacid|X-1550|(4'-Methoxy[1,1'-biphenyl]-3-yl)acetic acid|2-{4'-methoxy-[1,1'-biphenyl]-3-yl}acetic acid|2-Amino-4-oxo-1,4-dihydropyrimidine-5-carbonitrile
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.0943 g/mol |
| LogP | 2.9893 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 242.0943 |
| Monoisotopic Mass | 242.0943 |
| Heavy Atoms | 18 |
| Complexity | 543.9201 |
Chemical Identifiers
| CAS Number | 75852-49-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C2=CC=CC(=C2)CC(=O)O |
Product Overview
(1,1'-Biphenyl)-3-acetic acid, 4'-methoxy- (CAS 75852-49-2), with molecular formula C15H14O3 and molecular weight 242.0943 g/mol. IUPAC: 2-[3-(4-methoxyphenyl)phenyl]acetic acid.