2,6-Dichloro-4-(2-methylbutan-2-yl)phenol
2,6-dichloro-4-(2-methylbutan-2-yl)phenol
Also Known As: 2,6-Dichloro-4-(tert-pentyl)phenol|3,3-Dimethylbutyraldehyde|2,6-dichloro-4-(2-methylbutan-2-yl)phenol|NIOSH/SK9575000|Phenol,2,6-dichloro-4-(1,1-dimethylpropyl)-|2,6-DICHLORO-4- -PHENOL|2,6-Dichloro-4-(Tert-Pentyl)-Phenol|Phenol, 2,6-dichloro-4-(1,1-dimethylpropyl)-|2,6-Dichloro-4-(1,1-dimethylpropyl)phenol|4-(1,1-dimethylpropyl)-2,6-dichlorophenol|2,6-DICHLORO-4-(TERT.-PENTYL)-PHENOL
| Molecular Formula | C11H14Cl2O |
|---|---|
| Molecular Weight | 232.04218 g/mol |
| LogP | 5.0 |
| Topological Polar Surface Area | 20.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 232.04218 |
| Monoisotopic Mass | 232.04218 |
| Heavy Atoms | 14 |
| Complexity | 182.0 |
Chemical Identifiers
| CAS Number | 75908-77-9 |
|---|---|
| SMILES | CCC(C)(C)C1=CC(=C(C(=C1)Cl)O)Cl |
| InChIKey | PNVAMJAIDPAKST-UHFFFAOYSA-N |
Product Overview
2,6-Dichloro-4-(2-methylbutan-2-yl)phenol (CAS 75908-77-9), with molecular formula C11H14Cl2O and molecular weight 232.04218 g/mol. IUPAC: 2,6-dichloro-4-(2-methylbutan-2-yl)phenol.
2,6-Dichloro-4-(2-methylbutan-2-yl)phenol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »