(Phenylazo)thioformic acid 2-phenylhydrazide
1-anilino-3-phenyliminothiourea
Also Known As: DITHIZONE|Diphenylthiocarbazone|Dithizon|Ditizon|Dithizone E-form|Dithizone [MI]|1,5-Diphenylthiocarbazone|Carbazone, diphenylthio-|USAF EK-3092|Dithizone ACS grade|diphenyl thiocarbazone|Dithizone (E-form)|(Phenylazo)thioformic acid 2-phenylhydrazide|1,5-Diphenyl-3-mercaptoformazan|1-anilino-3-phenyliminothiourea|1,5-Diphenyl-3-thiocarbazone|3-Formazanthiol, 1,5-diphenyl-|Dithizone, Practical Grade|NCIOpen2_006427|(E)-1,5-Diphenylthiocarbazone|Diphenylthiocarbazone [WHO-DD]|3-Formazanthiol,5-diphenyl-|N',2-Diphenyldiazenecarbothiohydrazide|1,5-diphenyl-3-thiocarbazon|EINECS 200-454-1|Formic acid, 2-phenylhydrazide|Diazenecarbothioic acid, phenyl-, 2-phenylhydrazide|3-mercapto-1,5-diphenylformazan|1-anilino-3-phenylimino-thiourea
| Molecular Formula | C13H12N4S |
|---|---|
| Molecular Weight | 256.07828 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 80.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 256.07828 |
| Monoisotopic Mass | 256.07828 |
| Heavy Atoms | 18 |
| Complexity | 281.0 |
Chemical Identifiers
| CAS Number | 760132-01-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)NNC(=S)N=NC2=CC=CC=C2 |
| InChIKey | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 22 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(Phenylazo)thioformic acid 2-phenylhydrazide (CAS 760132-01-2), with molecular formula C13H12N4S and molecular weight 256.07828 g/mol. IUPAC: 1-anilino-3-phenyliminothiourea.