AC1MI1T5
2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+)
Also Known As: Manganese, ((2-((dithiocarboxy)amino)ethyl)carbamodithioato(2-)-kappaS,kappaS')-, mixt. with 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide|4-IMIDAZOLIDINONE, 5-((4-CHLOROPHENYL)METHYLENE)-3-(4-METHYLPHENYL)-2-SELENOXO-|2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide; N-[2-(disulfidomethylamino)ethyl]carbamodithioate; manganese(2+)
| Molecular Formula | C18H23ClMnN3O3S4- |
|---|---|
| Molecular Weight | 546.9691 g/mol |
| LogP | 1.56304 |
| Topological Polar Surface Area | 70.67 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Exact Mass | 546.9691 |
| Monoisotopic Mass | 546.9691 |
| Heavy Atoms | 30 |
| Complexity | 707.66705 |
Chemical Identifiers
| CAS Number | 76110-41-3 |
|---|---|
| SMILES | CC1=C(C(=CC=C1)C)N(C2CCOC2=O)C(=O)CCl.C(CNC(=S)[S-])NC([S-])[S-].[Mn+2] |
Product Overview
AC1MI1T5 (CAS 76110-41-3), with molecular formula C18H23ClMnN3O3S4- and molecular weight 546.9691 g/mol. IUPAC: 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide;N-[2-(disulfidomethylamino)ethyl]carbamodithioate;manganese(2+).