N-phenyl-1-(p-tolyl)ethan-1-imine
1-(4-methylphenyl)-N-phenylethanimine
Also Known As: N-phenyl-1-(p-tolyl)ethan-1-imine|1-(4-methylphenyl)-N-phenylethanimine|N-(alpha,4-Dimethylbenzylidene)aniline|N-Phenyl-1-(4-methylphenyl)ethaneimine|N-[1-(4-Methylphenyl)ethylidene]aniline|N-[1-[4-Methylphenyl]ethylidene]aniline|N-Phenyl-alpha,4-dimethylbenzylideneamine|(E)-N-Phenyl-1-(p-tolyl)ethan-1-imine|1-(4-methylphenyl)-N-phenylethan-1-imine|alpha,4-Dimethyl-N-phenylbenzenemethaneimine|N-(p-Methyl-alpha-methylbenzylidene)aniline|N-Phenyl-alpha,4-dimethylbenzenemethanimine|J1.150.134F|N-[(1E)-1-(4-methylphenyl)ethylidene]aniline
| Molecular Formula | C15H15N |
|---|---|
| Molecular Weight | 209.12045 g/mol |
| LogP | 3.8 |
| Topological Polar Surface Area | 12.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 209.12045 |
| Monoisotopic Mass | 209.12045 |
| Heavy Atoms | 16 |
| Complexity | 230.0 |
Chemical Identifiers
| CAS Number | 76154-06-8 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(=NC2=CC=CC=C2)C |
| InChIKey | RBQSPRGWJMNFTG-UHFFFAOYSA-N |
Product Overview
N-phenyl-1-(p-tolyl)ethan-1-imine (CAS 76154-06-8), with molecular formula C15H15N and molecular weight 209.12045 g/mol. IUPAC: 1-(4-methylphenyl)-N-phenylethanimine.
N-phenyl-1-(p-tolyl)ethan-1-imine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »