N-[(1,1-Dimethylethoxy)carbonyl]-D-phenylalanylglycine methyl ester
methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate
Also Known As: methyl N-(tert-butoxycarbonyl)phenylalanylglycinate|Methyl N-(tert-butoxycarbonyl)-D-phenylalanylglycinate|N-[(1,1-Dimethylethoxy)carbonyl]-D-phenylalanylglycine methyl ester|(S)-Methyl 2-(2-((tert-butoxycarbonyl)amino)-3-phenylpropanamido)acetate|N-((1,1-Dimethylethoxy)carbonyl)-D-phenylalanylglycine methyl ester|methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate
| Molecular Formula | C17H24N2O5 |
|---|---|
| Molecular Weight | 336.16852 g/mol |
| LogP | 1.9 |
| Topological Polar Surface Area | 93.7 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 336.16852 |
| Monoisotopic Mass | 336.16852 |
| Heavy Atoms | 24 |
| Complexity | 439.0 |
Chemical Identifiers
| CAS Number | 7625-57-2 |
|---|---|
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)C(=O)NCC(=O)OC |
| InChIKey | KRYDBLGWCUNDCJ-CYBMUJFWSA-N |
Product Overview
N-[(1,1-Dimethylethoxy)carbonyl]-D-phenylalanylglycine methyl ester (CAS 7625-57-2), with molecular formula C17H24N2O5 and molecular weight 336.16852 g/mol. IUPAC: methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetate.