Ethyl 2-amino-5-propylthiophene-3-carboxylate
ethyl 2-amino-5-propylthiophene-3-carboxylate
Also Known As: ethyl 2-amino-5-propylthiophene-3-carboxylate|AKOS MSC-0426|1923AC|QC-854|Ethyl2-amino-5-propylthiophene-3-carboxylate|Methyl-5-bromomethylpyridine-2-carboxylate|Ethyl 2-amino-5-propyl-thiophene-3-carboxylate|Ethyl 2-amino-5-n-propyl-thiophene-3-carboxylate|Ethyl 2-amino-5-propyl-3-thiophenecarboxylate|W-8832|3-Thiophenecarboxylic acid, 2-amino-5-propyl-, ethyl ester|I05-2319|2-amino-5-propyl-3-thiophenecarboxylic acid, ethyl ester|Ethyl 2-amino-5-propylthiophene-3-carboxylate, AldrichCPR|814-595-7
| Molecular Formula | C10H15NO2S |
|---|---|
| Molecular Weight | 213.08235 g/mol |
| LogP | 2.4595 |
| Topological Polar Surface Area | 52.32 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 213.08235 |
| Monoisotopic Mass | 213.08235 |
| Heavy Atoms | 14 |
| Complexity | 319.92194 |
Chemical Identifiers
| CAS Number | 76575-31-0 |
|---|---|
| SMILES | CCCC1=CC(=C(S1)N)C(=O)OCC |
Product Overview
Ethyl 2-amino-5-propylthiophene-3-carboxylate (CAS 76575-31-0), with molecular formula C10H15NO2S and molecular weight 213.08235 g/mol. IUPAC: ethyl 2-amino-5-propylthiophene-3-carboxylate.