![2,3-Dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone structure](/static/products/7682/768291-46-9.webp)
2,3-Dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone
2,3-dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone
Also Known As: BAS 09535470|indolinyl 2-(2-methoxyethylthio)phenyl ketone|2,3-dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone|(2,3-Dihydro-indol-1-yl)-[2-(2-methoxy-ethylsulfanyl)-phenyl]-methanone|1-{2-[(2-METHOXYETHYL)SULFANYL]BENZOYL}-2,3-DIHYDRO-1H-INDOLE|2,3-dihydro-1H-indol-1-yl{2-[(2-methoxyethyl)sulfanyl]phenyl}methanone
| Molecular Formula | C18H19NO2S |
|---|---|
| Molecular Weight | 313.11365 g/mol |
| LogP | 3.628 |
| Topological Polar Surface Area | 29.54 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 313.11365 |
| Monoisotopic Mass | 313.11365 |
| Heavy Atoms | 22 |
| Complexity | 671.64166 |
Chemical Identifiers
| CAS Number | 768291-46-9 |
|---|---|
| SMILES | COCCSC1=CC=CC=C1C(=O)N2CCC3=CC=CC=C32 |
Product Overview
2,3-Dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone (CAS 768291-46-9), with molecular formula C18H19NO2S and molecular weight 313.11365 g/mol. IUPAC: 2,3-dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone.
2,3-Dihydroindol-1-yl-[2-(2-methoxyethylsulfanyl)phenyl]methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »