Sungard B
2,3-bis[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy]propyl 2-ethylhexanoate
Also Known As: Sungard B|UVB 310|Di-(p-methoxycinnamoyloxy)-mono-(2'-ethylhexanoyloxy)propane|Hexanoic acid, 2-ethyl-, ester with 1,2,3-propanetriol bis(3-(4-methoxyphenyl)-2-propenoate)|2,3-bis[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy]propyl 2-ethylhexanoate|Glycerol 1,2-bis[(E)-3-(4-methoxyphenyl)propenoate]3-(2-ethylhexanoate)|2,3-BIS({[(2E)-3-(4-METHOXYPHENYL)PROP-2-ENOYL]OXY})PROPYL 2-ETHYLHEXANOATE|Hexanoic acid, 2-ethyl-, ester with 1,2,3-propanetriol bis[3-(4-methoxyphenyl)-2-propenoate]
| Molecular Formula | C31H38O8 |
|---|---|
| Molecular Weight | 538.25665 g/mol |
| LogP | 5.645 |
| Topological Polar Surface Area | 97.36 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Exact Mass | 538.25665 |
| Monoisotopic Mass | 538.25665 |
| Heavy Atoms | 39 |
| Complexity | 1086.5769 |
Chemical Identifiers
| CAS Number | 76840-16-9 |
|---|---|
| SMILES | CCCCC(CC)C(=O)OCC(COC(=O)/C=C/C1=CC=C(C=C1)OC)OC(=O)/C=C/C2=CC=C(C=C2)OC |
Product Overview
Sungard B (CAS 76840-16-9), with molecular formula C31H38O8 and molecular weight 538.25665 g/mol. IUPAC: 2,3-bis[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy]propyl 2-ethylhexanoate.
Sungard B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »