Methenammonium chloride
1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride
Also Known As: methenammonium chloride|Busan 1024|BUSAN 1500|1-METHYLHEXAMINIUM CHLORIDE|1-Methyl-3,5,7-triaza-1-azoniaadamantane chloride|METHENAMMONIUM CHLORIDE [INCI]|N-methylhexamethylenetetramine chloride|BL-3056|1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;chloride|1-Methyl-3,5,7-triaza-1-azonia tricyclo (3.3.1.1.(3.7)) decane|3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.13,7)DECANE, 1-METHYL-, CHLORIDE (1:1)|METHYL-3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.1(3,7))DECANE CHLORIDE, 1-|1-Methyl-1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decan-1-ium chloride|3,5,7-Triaza-1-azoniatricyclo(3.3.1.1(3,7))decane,1-methyl-, chloride|3,5,7-Triaza-1-azoniatricyclo(3.3.1.13,7)decane, 1-methyl-, chloride|3,5,7-Triaza-1-azoniatricyclo(3.3.1.1(superscript3,7))decane, 1-methyl-, chloride|3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-methyl-, chloride (1:1)|616-409-8
| Molecular Formula | C7H15ClN4 |
|---|---|
| Molecular Weight | 190.09853 g/mol |
| LogP | -3.8712 |
| Topological Polar Surface Area | 9.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 190.09853 |
| Monoisotopic Mass | 190.09853 |
| Heavy Atoms | 12 |
| Complexity | 150.0 |
Chemical Identifiers
| CAS Number | 76902-90-4 |
|---|---|
| SMILES | C[N+]12CN3CN(C1)CN(C3)C2.[Cl-] |
| InChIKey | XUTDJVFRVABGQY-UHFFFAOYSA-M |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methenammonium chloride (CAS 76902-90-4), with molecular formula C7H15ClN4 and molecular weight 190.09853 g/mol. IUPAC: 1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride.