6-Chloro-2-(methylsulfanyl)-1H-benzimidazole
6-chloro-2-methylsulfanyl-1H-benzimidazole
Also Known As: 6-CHLORO-2-(METHYLTHIO)-1H-BENZO[D]IMIDAZOLE|6-chloro-2-methylthiobenzimidazole|5-Chloro-2-[methylthio]benzimidazole|6-chloro-2-methylsulfanyl-1H-benzimidazole|7-((trimethylsilyl)ethynyl)-1H-indazole|5-Chloro-1H-benzimidazol-2-yl methyl sulfide|6-Chloro-2-(methylsulfanyl)-1H-benzimidazole|5-Chloro-2-(methylthio)-1H-benzimidazole|5-Chloro-2-methylsulfanyl-3h-benzoimidazole|1H-Benzimidazole, 5-chloro-2-(methylthio)-|5-chloro-2-(methylsulfanyl)-1H-1,3-benzodiazole|J1.567.018E|Methyl 5-chloro-1H-benzimidazole-2-yl sulfide|5-Chloro-1H-benzimidazol-2-yl methyl sulfide #|AO-185/13958012|1H-Benzimidazole, 5-chloro-2-(methylthio)- (9CI)|6-Chloro-2-(methylsulfanyl)-1H-1,3-benzimidazole
| Molecular Formula | C8H7ClN2S |
|---|---|
| Molecular Weight | 198.00185 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 54.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 198.00185 |
| Monoisotopic Mass | 198.00185 |
| Heavy Atoms | 12 |
| Complexity | 167.0 |
Chemical Identifiers
| CAS Number | 7692-57-1 |
|---|---|
| SMILES | CSC1=NC2=C(N1)C=C(C=C2)Cl |
| InChIKey | ZYJPSJQXODTXBZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6-Chloro-2-(methylsulfanyl)-1H-benzimidazole (CAS 7692-57-1), with molecular formula C8H7ClN2S and molecular weight 198.00185 g/mol. IUPAC: 6-chloro-2-methylsulfanyl-1H-benzimidazole.
6-Chloro-2-(methylsulfanyl)-1H-benzimidazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »