AC1L4HA2
N-[[3,5-dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide
Also Known As: Benzamide, N-(((3,5-dichloro-4-((2,2-dichlorocyclopropyl)methoxy)phenyl)amino)carbonyl)-2,6-difluoro-|N-[[3,5-dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-2,6-difluoro-benzamide|Benzamide, N-[[[3,5-dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]amino]carbonyl]-2,6-difluoro-|N-[({3,5-Dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl}imino)(hydroxy)methyl]-2,6-difluorobenzene-1-carboximidic acid|N-[[3,5-dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide
| Molecular Formula | C18H12Cl4F2N2O3 |
|---|---|
| Molecular Weight | 481.957 g/mol |
| LogP | 5.6 |
| Topological Polar Surface Area | 67.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 481.957 |
| Monoisotopic Mass | 481.957 |
| Heavy Atoms | 29 |
| Complexity | 608.0 |
Chemical Identifiers
| CAS Number | 77366-16-6 |
|---|---|
| SMILES | C1C(C1(Cl)Cl)COC2=C(C=C(C=C2Cl)NC(=O)NC(=O)C3=C(C=CC=C3F)F)Cl |
| InChIKey | NFXZVKGFNWNQEQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
AC1L4HA2 (CAS 77366-16-6), with molecular formula C18H12Cl4F2N2O3 and molecular weight 481.957 g/mol. IUPAC: N-[[3,5-dichloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide.