ethyl (2Z)-(3-oxopiperazin-2-ylidene)ethanoate
ethyl (2Z)-2-(3-oxopiperazin-2-ylidene)acetate
Also Known As: ethyl (2Z)-(3-oxopiperazin-2-ylidene)ethanoate|ethyl (2Z)-2-(3-oxopiperazin-2-ylidene)acetate|ethyl (2E)-(3-oxopiperazin-2-ylidene)acetate|ethyl (3-oxo-2-piperazinylidene)acetate|ETHYL 2-(3-OXO-2-PIPERAZINYLIDENE)ACETATE|ethyl 2-[(2Z)-3-oxopiperazin-2-ylidene]acetate|Ethyl (2Z)-(3-oxopiperazin-2-ylidene)acetate|Ethyl (2E)-(3-oxo-2-piperazinylidene)ethanoate|Acetic acid, (3-oxopiperazinylidene)-, ethyl ester, (Z)- (9CI)|ethyl 2-(3-oxo-1,4-diazaperhydroin-2-ylidene)acetate|ETHYL 2-[3-OXOTETRAHYDRO-2(1H)-PYRAZINYLIDEN]ACETATE|(4S,8AS)-1-OXOOCTAHYDROPYRROLO[1,2-A]PYRAZINE-4-CARBOXYLIC ACID
| Molecular Formula | C8H12N2O3 |
|---|---|
| Molecular Weight | 184.0848 g/mol |
| LogP | -0.8472 |
| Topological Polar Surface Area | 67.43 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 184.0848 |
| Monoisotopic Mass | 184.0848 |
| Heavy Atoms | 13 |
| Complexity | 247.7737 |
Chemical Identifiers
| CAS Number | 774-89-0 |
|---|---|
| SMILES | CCOC(=O)/C=C\1/C(=O)NCCN1 |
Product Overview
ethyl (2Z)-(3-oxopiperazin-2-ylidene)ethanoate (CAS 774-89-0), with molecular formula C8H12N2O3 and molecular weight 184.0848 g/mol. IUPAC: ethyl (2Z)-2-(3-oxopiperazin-2-ylidene)acetate.