N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine
N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine
Also Known As: Oprea1_353334|AN-465/41519689|[5-Bromo-2-(thiophen-2-ylmethoxy)-benzyl]-tert-butyl-amine|N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine|N-[5-bromo-2-(2-thienylmethoxy)benzyl]-2-methyl-2-propanamine|N-[5-bromo-2-(thien-2-ylmethoxy)benzyl]-N-(tert-butyl)amine|N-[5-BROMO-2-(2-THIENYLMETHOXY)BENZYL]-N-(TERT-BUTYL)AMINE
| Molecular Formula | C16H20BrNOS |
|---|---|
| Molecular Weight | 353.0449 g/mol |
| LogP | 4.9777 |
| Topological Polar Surface Area | 21.26 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 353.0449 |
| Monoisotopic Mass | 353.0449 |
| Heavy Atoms | 20 |
| Complexity | 546.0997 |
Chemical Identifiers
| CAS Number | 774191-41-2 |
|---|---|
| SMILES | CC(C)(C)NCC1=C(C=CC(=C1)Br)OCC2=CC=CS2 |
Product Overview
N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine (CAS 774191-41-2), with molecular formula C16H20BrNOS and molecular weight 353.0449 g/mol. IUPAC: N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine.
N-[[5-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »