2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole
2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole
Also Known As: 2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole|2-[(2-chloro-4-nitrophenyl)thio]-1H-benzo[d]imidazole|2-[(2-chloro-4-nitrophenyl)thio]-1H-benzimidazole|SR-01000467432-1|SR-01000467432-2|2-(2-chloro-4-nitro-phenyl)sulfanyl-1H-benzimidazole|2-(2-Chloro-4-nitro-phenylsulfanyl)-1H-benzoimidazole|2-[(2-Chloro-4-nitrophenyl)sulfanyl]-1H-1,3-benzimidazole
| Molecular Formula | C13H8ClN3O2S |
|---|---|
| Molecular Weight | 305.00256 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 99.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 305.00256 |
| Monoisotopic Mass | 305.00256 |
| Heavy Atoms | 20 |
| Complexity | 368.0 |
Chemical Identifiers
| CAS Number | 77436-85-2 |
|---|---|
| SMILES | C1=CC=C2C(=C1)NC(=N2)SC3=C(C=C(C=C3)[N+](=O)[O-])Cl |
| InChIKey | SRXOFLCHVCMEAH-UHFFFAOYSA-N |
Product Overview
2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole (CAS 77436-85-2), with molecular formula C13H8ClN3O2S and molecular weight 305.00256 g/mol. IUPAC: 2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole.
2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »