Ethyl Indole-3-carboxylate
ethyl 1H-indole-3-carboxylate
Also Known As: Ethyl indole-3-carboxylate|ethyl 1H-indole-3-carboxylate|Indole-3-carboxylic acid ethyl ester|1H-indole-3-carboxylic acid ethyl ester|(-)-alpha-Cubebene|3-(Ethoxycarbonyl)indole|lindole-3-ethyl formate|Ethylindole-3-carboxylate|NCIOpen2_000288|1H-Indole-3-carboxylic acid, ethyl ester|ethyl_indole_3_carboxylic_acid|3-Indolecarboxylicacidethylester|Ethyl indole-3-carboxylate CRS|Ethyl indole-3-carboxylate 97%|Ethyl indole-3-carboxylate, 96%|CE-088|INDOLE3CARBOXYLICACIDETHYLESTER|KM1870|Indole-3-carboxylic acid, ethyl ester|CS-W015944|RD-0091|KS-0000022B
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.07898 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 42.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 189.07898 |
| Monoisotopic Mass | 189.07898 |
| Heavy Atoms | 14 |
| Complexity | 217.0 |
Chemical Identifiers
| CAS Number | 776-41-0 |
|---|---|
| SMILES | CCOC(=O)C1=CNC2=CC=CC=C21 |
| InChIKey | XOUHVMVYFOXTMN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl Indole-3-carboxylate (CAS 776-41-0), with molecular formula C11H11NO2 and molecular weight 189.07898 g/mol. IUPAC: ethyl 1H-indole-3-carboxylate.