Diazene, bis(3,5-dimethylphenyl)-
bis(3,5-dimethylphenyl)diazene
Also Known As: Bis diazene|Diazene, bis(3,5-dimethylphenyl)-|bis(3,5-dimethylphenyl)diazene|1,2-Bis(3,5-dimethylphenyl)diazene|(E)-bis(3,5-dimethylphenyl)diazene|3,3',5,5'-tetramethylazobenzene|(Z)-bis(3,5-dimethylphenyl)diazene|5,5 -Azobis(1,3-dimethylbenzene)|trans-3,3',5,5'-tetramethylazobenzene|3,3 ,5,5 -Tetramethylazobenzene|(E)-1,2-Bis(3,5-dimethylphenyl)diazene|(E)-1,2-Bis(3,5-dimethylphenyl)diazene #|(E)-3,3 ,5,5 -Tetramethylazobenzene|(Z)-3,3 ,5,5 -Tetramethylazobenzene|J3.350.006H|J3.480.261K
| Molecular Formula | C16H18N2 |
|---|---|
| Molecular Weight | 238.147 g/mol |
| LogP | 5.2 |
| Topological Polar Surface Area | 24.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 238.147 |
| Monoisotopic Mass | 238.147 |
| Heavy Atoms | 18 |
| Complexity | 239.0 |
Chemical Identifiers
| CAS Number | 77611-71-3 |
|---|---|
| SMILES | CC1=CC(=CC(=C1)N=NC2=CC(=CC(=C2)C)C)C |
| InChIKey | KQJYKIFOKLVEKF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Diazene, bis(3,5-dimethylphenyl)- (CAS 77611-71-3), with molecular formula C16H18N2 and molecular weight 238.147 g/mol. IUPAC: bis(3,5-dimethylphenyl)diazene.