Methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
Also Known As: Methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate|methyl |A-methoxy-|A-trifluoromethylphenylacetate|alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid methyl ester|methyl 3,3,3-trifluoro-2-methoxy-2-phenyl-propanoate|methyl alpha-methoxy-alpha-trifluoromethylphenylacetate||A-phenyl-|A-methoxytrifluoropropionic acid methyl ester|Methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate #||A-Methoxy-|A-(trifluoromethyl)benzeneacetic acid methyl ester|Benzeneacetic acid, .alpha.-methoxy-.alpha.-(trifluoromethyl)-, methyl ester|Benzeneacetic acid, alpha-methoxy-alpha-(trifluoromethyl)-, methyl ester|alpha-Methoxy-alpha-(trifluoromethyl)benzeneacetic acid methyl ester
| Molecular Formula | C11H11F3O3 |
|---|---|
| Molecular Weight | 248.06602 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 248.06602 |
| Monoisotopic Mass | 248.06602 |
| Heavy Atoms | 17 |
| Complexity | 272.0 |
Chemical Identifiers
| CAS Number | 77611-72-4 |
|---|---|
| SMILES | COC(=O)C(C1=CC=CC=C1)(C(F)(F)F)OC |
| InChIKey | RGACWXDYKJJHSQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (CAS 77611-72-4), with molecular formula C11H11F3O3 and molecular weight 248.06602 g/mol. IUPAC: methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.