4-Butyl-4'-methoxyazobenzene
(4-butylphenyl)-(4-methoxyphenyl)diazene
Also Known As: BMAB|4-Butyl-4'-methoxyazobenzene|p-n-Butyl-p'-methoxy-azobenzol|4 -Butyl-4-methoxyazobenzene|4-Butyl-4 -methoxyazobenzene|4-Methoxy-4 -butylazobenzene|trans-4-butyl-4'-methoxyazobenzene|(4-butylphenyl)-(4-methoxyphenyl)diazene|(E)-4-Butyl-4 -methoxyazobenzene|(Z)-4-Butyl-4 -methoxyazobenzene|Diazene, (4-butylphenyl)(4-methoxyphenyl)-|(Z)-(4-butylphenyl)(4-methoxyphenyl)diazene|J1.297.198B|(4-BUTYLPHENYL)(4-METHOXYPHENYL)DIAZENE|(E)-1-(4-Butylphenyl)-2-(4-methoxyphenyl)diazene|(E)-(4-BUTYLPHENYL)(4-METHOXYPHENYL)DIAZENE
| Molecular Formula | C17H20N2O |
|---|---|
| Molecular Weight | 268.15756 g/mol |
| LogP | 5.4532 |
| Topological Polar Surface Area | 33.95 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 268.15756 |
| Monoisotopic Mass | 268.15756 |
| Heavy Atoms | 20 |
| Complexity | 544.20764 |
Chemical Identifiers
| CAS Number | 77643-98-2 |
|---|---|
| SMILES | CCCCC1=CC=C(C=C1)N=NC2=CC=C(C=C2)OC |
Product Overview
4-Butyl-4'-methoxyazobenzene (CAS 77643-98-2), with molecular formula C17H20N2O and molecular weight 268.15756 g/mol. IUPAC: (4-butylphenyl)-(4-methoxyphenyl)diazene.