Cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid
cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid
Also Known As: cyclohexanamine,1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-|1-(4-Methylbenzene-1-sulfonyl)-5-oxoproline--cyclohexanamine (1/1)|cyclohexanamine; 1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid|Cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid
| Molecular Formula | C18H26N2O5S |
|---|---|
| Molecular Weight | 382.15625 g/mol |
| LogP | 2.03712 |
| Topological Polar Surface Area | 126.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 382.15625 |
| Monoisotopic Mass | 382.15625 |
| Heavy Atoms | 26 |
| Complexity | 519.0 |
Chemical Identifiers
| CAS Number | 7770-20-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(CCC2=O)C(=O)O.C1CCC(CC1)N |
| InChIKey | JEWJNMJRWRIZQV-UHFFFAOYSA-N |
Product Overview
Cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid (CAS 7770-20-9), with molecular formula C18H26N2O5S and molecular weight 382.15625 g/mol. IUPAC: cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid.
Cyclohexanamine;1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »