![N-[(E)-(9-ethyl-9H-carbazol-3-yl)methylidene]-4-methoxyaniline structure](/static/products/777/77702-85-3.png)
N-[(E)-(9-ethyl-9H-carbazol-3-yl)methylidene]-4-methoxyaniline
1-(9-ethylcarbazol-3-yl)-N-(4-methoxyphenyl)methanimine
Also Known As: TimTec1_002527|Oprea1_544999|Oprea1_708904|KS-000049Y7|NCGC00174027-01|N-[(9-ethyl-9H-carbazol-3-yl)methylene]-4-methoxyaniline|1-(9-ethylcarbazol-3-yl)-N-(4-methoxyphenyl)methanimine|(E)-1-(9-ethylcarbazol-3-yl)-N-(4-methoxyphenyl)methanimine|1-[(1E)-2-(9-ethylcarbazol-3-yl)-1-azavinyl]-4-methoxybenzene|N-[(E)-(9-ethyl-9H-carbazol-3-yl)methylidene]-4-methoxyaniline
| Molecular Formula | C22H20N2O |
|---|---|
| Molecular Weight | 328.15756 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 26.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 328.15756 |
| Monoisotopic Mass | 328.15756 |
| Heavy Atoms | 25 |
| Complexity | 457.0 |
Chemical Identifiers
| CAS Number | 77702-85-3 |
|---|---|
| SMILES | CCN1C2=C(C=C(C=C2)C=NC3=CC=C(C=C3)OC)C4=CC=CC=C41 |
| InChIKey | GPOLVRIZLLMMCX-UHFFFAOYSA-N |
Product Overview
N-[(E)-(9-ethyl-9H-carbazol-3-yl)methylidene]-4-methoxyaniline (CAS 77702-85-3), with molecular formula C22H20N2O and molecular weight 328.15756 g/mol. IUPAC: 1-(9-ethylcarbazol-3-yl)-N-(4-methoxyphenyl)methanimine.
N-[(E)-(9-ethyl-9H-carbazol-3-yl)methylidene]-4-methoxyaniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »