2,3-Dihydro-1H-phenanthren-4-one
2,3-dihydro-1H-phenanthren-4-one
Also Known As: 2,3-Dihydrophenanthren-4(1H)-one|2,3-Dihydro-1H-phenanthren-4-one|1,2,3,4-Tetrahydrophenanthren-4-one|1,2-Dihydro-4(3H)-phenanthrenone|4(1H)-Phenanthrenone, 2,3-dihydro-|KS-00002BGI|2,3-Dihydro-4(1H)-phenanthrenone|4-Oxo-1,2,3,4-tetrahydrophenanthrene|1,2,3,4-tetrahydro-4-phenanthrone|1,2-Dihydrophenanthrene-4(3H)-one|9653AE|4(1H)-Phenanthrenone,2,3-dihydro-|4(1H)-Phenanthrone, 2,3-dihydro-|2,3-Dihydro-4(1H)-phenanthrenone #|CS-W015702|SS-4964|1,2,3,4-Tetrahydrophenanthrene-4-one|4-keto-1,2,3,4-tetrahydro-phenanthrene
| Molecular Formula | C14H12O |
|---|---|
| Molecular Weight | 196.08882 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 196.08882 |
| Monoisotopic Mass | 196.08882 |
| Heavy Atoms | 15 |
| Complexity | 258.0 |
Chemical Identifiers
| CAS Number | 778-48-3 |
|---|---|
| SMILES | C1CC2=C(C(=O)C1)C3=CC=CC=C3C=C2 |
| InChIKey | HQVRULPLURPAJY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,3-Dihydro-1H-phenanthren-4-one (CAS 778-48-3), with molecular formula C14H12O and molecular weight 196.08882 g/mol. IUPAC: 2,3-dihydro-1H-phenanthren-4-one.