Biphenyl-4-yl 4-methylbenzenesulfonate
(4-phenylphenyl) 4-methylbenzenesulfonate
Also Known As: 4-Tosyloxybiphenyl|4-(Tosyloxy)biphenyl|4-Biphenylyltosylate|biphenyl-4-yl 4-methylbenzenesulfonate|4-biphenylyl p-toluenesulphonate|(4-phenylphenyl) 4-methylbenzenesulfonate|4-phenylphenyl 4-methylbenzene-1-sulfonate|HS-4397|[1,1'-biphenyl]-4-yl 4-methylbenzene-1-sulfonate|[1,1'-biphenyl]-4-yl 4-methylbenzenesulfonate|4-Methylbenzenesulfonic acid 4-biphenylyl ester|AO-548/10509038|[1,1'-Biphenyl]-4-ol,4-(4-methylbenzenesulfonate)
| Molecular Formula | C19H16O3S |
|---|---|
| Molecular Weight | 324.082 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 51.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 324.082 |
| Monoisotopic Mass | 324.082 |
| Heavy Atoms | 23 |
| Complexity | 445.0 |
Chemical Identifiers
| CAS Number | 7787-41-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=C(C=C2)C3=CC=CC=C3 |
| InChIKey | CBYZELXTVBROSO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Biphenyl-4-yl 4-methylbenzenesulfonate (CAS 7787-41-9), with molecular formula C19H16O3S and molecular weight 324.082 g/mol. IUPAC: (4-phenylphenyl) 4-methylbenzenesulfonate.