AC1MHZEW
3-(dimethylamino)propyl 2-benzamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;hydrochloride
Also Known As: Benzo(b)thiophene-3-carboxylic acid, 4,5,6,7-tetrahydro-2-(benzoylamino)-, 3-(dimethylamino)propyl ester, monohydrochloride|3-(dimethylamino)propyl 2-benzamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate hydrochloride|3-(Dimethylamino)propyl 2-benzamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate--hydrogen chloride (1/1)|3-dimethylaminopropyl 2-benzamido-4,5,6,7-tetrahydrobenzothiophene-3-carboxylate Hydrochloride
| Molecular Formula | C21H27ClN2O3S |
|---|---|
| Molecular Weight | 422.1431 g/mol |
| LogP | 4.4095 |
| Topological Polar Surface Area | 58.64 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 422.1431 |
| Monoisotopic Mass | 422.1431 |
| Heavy Atoms | 28 |
| Complexity | 805.48206 |
Chemical Identifiers
| CAS Number | 78033-91-7 |
|---|---|
| SMILES | CN(C)CCCOC(=O)C1=C(SC2=C1CCCC2)NC(=O)C3=CC=CC=C3.Cl |
Product Overview
AC1MHZEW (CAS 78033-91-7), with molecular formula C21H27ClN2O3S and molecular weight 422.1431 g/mol. IUPAC: 3-(dimethylamino)propyl 2-benzamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;hydrochloride.