(E)-4-[(5R)-5,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one
(E)-4-[(5R)-5,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one
Also Known As: b-ionone|trans-beta-Ionone|(E)-beta-Ionone|beta-Ionone (trans)|3-(Aminomethyl)cyclohexylamine|FEMA No. 2595|EINECS 201-224-3|AI3-25073|(3E)-4-(2,6,6-trimethylcyclohex-1-en-1-yl)but-3-en-2-one|(E)-4-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-3-buten-2-one|trans-4-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-3-buten-2-one|(E)-4-[(5R)-5,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one|3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)-|3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (E)-
| Molecular Formula | C13H20O |
|---|---|
| Molecular Weight | 192.15141 g/mol |
| LogP | 3.5141 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 192.15141 |
| Monoisotopic Mass | 192.15141 |
| Heavy Atoms | 14 |
| Complexity | 281.6107 |
Chemical Identifiers
| CAS Number | 79-77-6 |
|---|---|
| SMILES | C[C@@H]1CCC=C(C1(C)C)/C=C/C(=O)C |
Product Overview
(E)-4-[(5R)-5,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one (CAS 79-77-6), with molecular formula C13H20O and molecular weight 192.15141 g/mol. IUPAC: (E)-4-[(5R)-5,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one.