Diethyl 2-[(4-fluorophenyl)methylene]malonate
diethyl 2-[(4-fluorophenyl)methylidene]propanedioate
Also Known As: diethyl 2-[(4-fluorophenyl)methylene]malonate|diethyl 2-[(4-fluorophenyl)methylidene]propanedioate|diethyl 2-(4-fluorobenzylidene)malonate|KS-00001R22|1,3-diethyl 2-[(4-fluorophenyl)methylidene]propanedioate|4-Fluorobenzylidenemalonic acid diethyl ester|(4-Fluorobenzylidene)malonic acid diethyl ester|10P-119|2-(4-fluorobenzylidene)malonic acid diethyl ester|Diethyl [(4-fluorophenyl)methylidene]propanedioate|diethyl 2-[(4-fluorophenyl)methylene]propanedioate|Propanedioic acid, [(4-fluorophenyl)methylene]-, diethyl ester|1,3-diethyl2-[(4-fluorophenyl)methylidene]propanedioate
| Molecular Formula | C14H15FO4 |
|---|---|
| Molecular Weight | 266.09543 g/mol |
| LogP | 2.3353 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 266.09543 |
| Monoisotopic Mass | 266.09543 |
| Heavy Atoms | 19 |
| Complexity | 456.72427 |
Chemical Identifiers
| CAS Number | 790-53-4 |
|---|---|
| SMILES | CCOC(=O)C(=CC1=CC=C(C=C1)F)C(=O)OCC |
Product Overview
Diethyl 2-[(4-fluorophenyl)methylene]malonate (CAS 790-53-4), with molecular formula C14H15FO4 and molecular weight 266.09543 g/mol. IUPAC: diethyl 2-[(4-fluorophenyl)methylidene]propanedioate.