2-(5-Acetamido-2-methoxybenzenesulfonamido)acetic acid
2-[(5-acetamido-2-methoxyphenyl)sulfonylamino]acetic acid
Also Known As: 2-(5-Acetamido-2-methoxybenzenesulfonamido)acetic acid|((5-Acetamido-2-methoxyphenyl)sulfonyl)glycine|2-[(5-acetamido-2-methoxyphenyl)sulfonylamino]acetic acid|({[5-(acetylamino)-2-methoxyphenyl]sulfonyl}amino)acetic acid|SR-01000060892-1|2-(5-Acetamido-2-methoxybenzenesulfonamido)aceticacid|2-[(5-acetamido-2-methoxy-phenyl)sulfonylamino]acetic Acid|(([5-(acetylamino)-2-methoxyphenyl]sulfonyl)amino)acetic acid
| Molecular Formula | C11H14N2O6S |
|---|---|
| Molecular Weight | 302.05725 g/mol |
| LogP | 0.0165 |
| Topological Polar Surface Area | 121.8 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 302.05725 |
| Monoisotopic Mass | 302.05725 |
| Heavy Atoms | 20 |
| Complexity | 625.80054 |
Chemical Identifiers
| CAS Number | 794584-41-1 |
|---|---|
| SMILES | CC(=O)NC1=CC(=C(C=C1)OC)S(=O)(=O)NCC(=O)O |
Product Overview
2-(5-Acetamido-2-methoxybenzenesulfonamido)acetic acid (CAS 794584-41-1), with molecular formula C11H14N2O6S and molecular weight 302.05725 g/mol. IUPAC: 2-[(5-acetamido-2-methoxyphenyl)sulfonylamino]acetic acid.
2-(5-Acetamido-2-methoxybenzenesulfonamido)acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »